C12H14N2O3S2 — CID 47389535
5-ethyl-N-(1-methyl-6-oxo-3-pyridinyl)thiophene-2-sulfonamide (PubChem CID 47389535) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-ethyl-N-(1-methyl-6-oxo-3-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(1-methyl-6-oxo-3-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 47389535 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-ethyl-N-(1-methyl-6-oxo-3-pyridinyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(=O)n(C)c2)s1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-3-10-5-7-12(18-10)19(16,17)13-9-4-6-11(15)14(2)8-9/h4-8,13H,3H2,1-2H3 |
| InChIKey | PEFCFRKVTGBKQD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |