C54H34N6O — CID 163603081
2-[3-[1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]dibenzofuran-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 163603081) has the molecular formula C54H34N6O and a molecular weight of 782.91 g/mol. Its IUPAC name is 2-[3-[1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]dibenzofuran-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]dibenzofuran-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163603081 |
| Molecular Formula | C54H34N6O |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.28 |
| IUPAC Name | 2-[3-[1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]dibenzofuran-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5oc6ccccc6c5c4-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C54H34N6O/c1-5-17-35(18-6-1)49-55-50(36-19-7-2-8-20-36)58-53(57-49)41-27-15-25-39(33-41)43-31-32-46-48(44-29-13-14-30-45(44)61-46)47(43)40-26-16-28-42(34-40)54-59-51(37-21-9-3-10-22-37)56-52(60-54)38-23-11-4-12-24-38/h1-34H |
| InChIKey | GZJQMNQVMRDZEU-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |