C12H17N3S2 — CID 163606265
1-pyridin-2-yl-2-[2-(1-sulfanylethyl)-4,5-dihydro-1H-imidazol-5-yl]ethanethiol (PubChem CID 163606265) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-[2-(1-sulfanylethyl)-4,5-dihydro-1H-imidazol-5-yl]ethanethiol.
| Compound Name | 1-pyridin-2-yl-2-[2-(1-sulfanylethyl)-4,5-dihydro-1H-imidazol-5-yl]ethanethiol |
|---|---|
| PubChem CID | 163606265 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-pyridin-2-yl-2-[2-(1-sulfanylethyl)-4,5-dihydro-1H-imidazol-5-yl]ethanethiol |
| SMILES | CC(S)C1=NCC(CC(S)c2ccccn2)N1 |
| InChI | InChI=1S/C12H17N3S2/c1-8(16)12-14-7-9(15-12)6-11(17)10-4-2-3-5-13-10/h2-5,8-9,11,16-17H,6-7H2,1H3,(H,14,15) |
| InChIKey | HCBSGBUWRHALHQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|