C4H4F6O4S2 — CID 163606703
2,2,3,3,4,4-hexafluoro-1-hydroxy-4-hydroxysulfanylbutane-1-sulfinic acid (PubChem CID 163606703) has the molecular formula C4H4F6O4S2 and a molecular weight of 294.19 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-1-hydroxy-4-hydroxysulfanylbutane-1-sulfinic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-1-hydroxy-4-hydroxysulfanylbutane-1-sulfinic acid |
|---|---|
| PubChem CID | 163606703 |
| Molecular Formula | C4H4F6O4S2 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-1-hydroxy-4-hydroxysulfanylbutane-1-sulfinic acid |
| SMILES | O=S(O)C(O)C(F)(F)C(F)(F)C(F)(F)SO |
| InChI | InChI=1S/C4H4F6O4S2/c5-2(6,1(11)16(13)14)3(7,8)4(9,10)15-12/h1,11-12H,(H,13,14) |
| InChIKey | HCKOGPZIGSJMEL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|