C25H27ClO4 — CID 163608414
ethyl 3-[2-(2-chloro-5-ethoxycarbonylphenyl)but-3-enyl]-4-prop-1-en-2-ylbenzoate (PubChem CID 163608414) has the molecular formula C25H27ClO4 and a molecular weight of 426.94 g/mol. Its IUPAC name is ethyl 3-[2-(2-chloro-5-ethoxycarbonylphenyl)but-3-enyl]-4-prop-1-en-2-ylbenzoate.
| Compound Name | ethyl 3-[2-(2-chloro-5-ethoxycarbonylphenyl)but-3-enyl]-4-prop-1-en-2-ylbenzoate |
|---|---|
| PubChem CID | 163608414 |
| Molecular Formula | C25H27ClO4 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethyl 3-[2-(2-chloro-5-ethoxycarbonylphenyl)but-3-enyl]-4-prop-1-en-2-ylbenzoate |
| SMILES | C=CC(Cc1cc(C(=O)OCC)ccc1C(=C)C)c1cc(C(=O)OCC)ccc1Cl |
| InChI | InChI=1S/C25H27ClO4/c1-6-17(22-15-19(10-12-23(22)26)25(28)30-8-3)13-20-14-18(24(27)29-7-2)9-11-21(20)16(4)5/h6,9-12,14-15,17H,1,4,7-8,13H2,2-3,5H3 |
| InChIKey | IDAGATYXEMRJFN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|