C24H26Cl2O6 — CID 68802326
ethyl 4-chloro-3-hydroxy-2-prop-2-enylbenzoate;ethyl 4-chloro-3-prop-2-enoxybenzoate (PubChem CID 68802326) has the molecular formula C24H26Cl2O6 and a molecular weight of 481.37 g/mol. Its IUPAC name is ethyl 4-chloro-3-hydroxy-2-prop-2-enylbenzoate;ethyl 4-chloro-3-prop-2-enoxybenzoate.
| Compound Name | ethyl 4-chloro-3-hydroxy-2-prop-2-enylbenzoate;ethyl 4-chloro-3-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 68802326 |
| Molecular Formula | C24H26Cl2O6 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | ethyl 4-chloro-3-hydroxy-2-prop-2-enylbenzoate;ethyl 4-chloro-3-prop-2-enoxybenzoate |
| SMILES | C=CCOc1cc(C(=O)OCC)ccc1Cl.C=CCc1c(C(=O)OCC)ccc(Cl)c1O |
| InChI | InChI=1S/2C12H13ClO3/c1-3-7-16-11-8-9(5-6-10(11)13)12(14)15-4-2;1-3-5-8-9(12(15)16-4-2)6-7-10(13)11(8)14/h3,5-6,8H,1,4,7H2,2H3;3,6-7,14H,1,4-5H2,2H3 |
| InChIKey | APERCNYNVKUHIU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|