C12H20O4 — CID 163608952
[(2S)-1-oxo-1-prop-2-enoxypropan-2-yl] (2R)-2,3-dimethylbutanoate (PubChem CID 163608952) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(2S)-1-oxo-1-prop-2-enoxypropan-2-yl] (2R)-2,3-dimethylbutanoate.
| Compound Name | [(2S)-1-oxo-1-prop-2-enoxypropan-2-yl] (2R)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 163608952 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(2S)-1-oxo-1-prop-2-enoxypropan-2-yl] (2R)-2,3-dimethylbutanoate |
| SMILES | C=CCOC(=O)[C@H](C)OC(=O)[C@H](C)C(C)C |
| InChI | InChI=1S/C12H20O4/c1-6-7-15-12(14)10(5)16-11(13)9(4)8(2)3/h6,8-10H,1,7H2,2-5H3/t9-,10+/m1/s1 |
| InChIKey | HEGCQZMMQUOMQJ-ZJUUUORDSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|