C43H28N5- — CID 163612011
2-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-4-(2H-pyridin-1-id-2-yl)-6-pyridin-2-yl-1,3,5-triazine (PubChem CID 163612011) has the molecular formula C43H28N5- and a molecular weight of 614.73 g/mol. Its IUPAC name is 2-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-4-(2H-pyridin-1-id-2-yl)-6-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-4-(2H-pyridin-1-id-2-yl)-6-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 163612011 |
| Molecular Formula | C43H28N5- |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 2-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-4-(2H-pyridin-1-id-2-yl)-6-pyridin-2-yl-1,3,5-triazine |
| SMILES | C1=C[N-]C(c2nc(-c3ccc(-c4c5ccccc5c(-c5ccc6ccccc6c5)c5ccccc45)cc3)nc(-c3ccccn3)n2)C=C1 |
| InChI | InChI=1S/C43H28N5/c1-2-12-31-27-32(24-19-28(31)11-1)40-35-15-5-3-13-33(35)39(34-14-4-6-16-36(34)40)29-20-22-30(23-21-29)41-46-42(37-17-7-9-25-44-37)48-43(47-41)38-18-8-10-26-45-38/h1-27,37H/q-1 |
| InChIKey | HGSXAJIFBJEWRV-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 65.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|