About [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate
[(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate (PubChem CID 163613497) has the molecular formula C23H22INO3
and a molecular weight of 487.34 g/mol. Its IUPAC name is [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate |
| PubChem CID | 163613497 |
| Molecular Formula | C23H22INO3 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate |
| SMILES | C/I=N/OC(=O)c1ccc(OCc2ccccc2)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H22INO3/c1-17(19-11-7-4-8-12-19)21-15-20(23(26)28-25-24-2)13-14-22(21)27-16-18-9-5-3-6-10-18/h3-15,17H,16H2,1-2H3 |
| InChIKey | HHYPAAMTAYSGDF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate?
The IUPAC name of [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate (CID 163613497) is [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate.
What is the SMILES notation for [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate?
The canonical SMILES for [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate is C/I=N/OC(=O)c1ccc(OCc2ccccc2)c(C(C)c2ccccc2)c1.
What is the InChIKey of [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate?
The InChIKey is HHYPAAMTAYSGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22INO3/c1-17(19-11-7-4-8-12-19)21-15-20(23(26)28-25-24-2)13-14-22(21)27-16-18-9-5-3-6-10-18/h3-15,17H,16H2,1-2H3.
What are the key properties of [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate?
[(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate has a molecular weight of 487.34 g/mol, XLogP of 6.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(methyl-λ3-iodanylidene)amino] 3-(1-phenylethyl)-4-phenylmethoxybenzoate is sourced from PubChem (CID 163613497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).