C29H35NO3 — CID 66779710
3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-phenylmethoxybenzoic acid (PubChem CID 66779710) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is 3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-phenylmethoxybenzoic acid.
| Compound Name | 3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 66779710 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-phenylmethoxybenzoic acid |
| SMILES | CCC(c1cccc(N(C(C)C)C(C)C)c1)c1cc(C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H35NO3/c1-6-26(23-13-10-14-25(17-23)30(20(2)3)21(4)5)27-18-24(29(31)32)15-16-28(27)33-19-22-11-8-7-9-12-22/h7-18,20-21,26H,6,19H2,1-5H3,(H,31,32) |
| InChIKey | WLWOMPNBJNILSX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |