C32H43NO4 — CID 70182364
[3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-pent-4-enoyloxyphenyl]methyl pent-4-enoate (PubChem CID 70182364) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is [3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-pent-4-enoyloxyphenyl]methyl pent-4-enoate.
| Compound Name | [3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-pent-4-enoyloxyphenyl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 70182364 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | [3-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]-4-pent-4-enoyloxyphenyl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCc1ccc(OC(=O)CCC=C)c(C(CC)c2cccc(N(C(C)C)C(C)C)c2)c1 |
| InChI | InChI=1S/C32H43NO4/c1-8-11-16-31(34)36-22-25-18-19-30(37-32(35)17-12-9-2)29(20-25)28(10-3)26-14-13-15-27(21-26)33(23(4)5)24(6)7/h8-9,13-15,18-21,23-24,28H,1-2,10-12,16-17,22H2,3-7H3 |
| InChIKey | DCVOELYHWOYQFM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|