C26H39NO2 — CID 70182376
4-(butoxymethyl)-2-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]phenol (PubChem CID 70182376) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 4-(butoxymethyl)-2-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]phenol.
| Compound Name | 4-(butoxymethyl)-2-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]phenol |
|---|---|
| PubChem CID | 70182376 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 4-(butoxymethyl)-2-[1-[3-[di(propan-2-yl)amino]phenyl]propyl]phenol |
| SMILES | CCCCOCc1ccc(O)c(C(CC)c2cccc(N(C(C)C)C(C)C)c2)c1 |
| InChI | InChI=1S/C26H39NO2/c1-7-9-15-29-18-21-13-14-26(28)25(16-21)24(8-2)22-11-10-12-23(17-22)27(19(3)4)20(5)6/h10-14,16-17,19-20,24,28H,7-9,15,18H2,1-6H3 |
| InChIKey | DMPLBEGKHMIEHY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|