C49H42N4S — CID 163614531
9-[4-[3-cyclohexa-1,3-dien-1-yl-5-(1,2-dihydropyridin-5-yl)phenyl]-1,2-dihydroquinazolin-2-yl]-2-(1,2-dihydrodibenzothiophen-2-yl)-4a,4b,8a,9a-tetrahydrocarbazole (PubChem CID 163614531) has the molecular formula C49H42N4S and a molecular weight of 718.97 g/mol. Its IUPAC name is 9-[4-[3-cyclohexa-1,3-dien-1-yl-5-(1,2-dihydropyridin-5-yl)phenyl]-1,2-dihydroquinazolin-2-yl]-2-(1,2-dihydrodibenzothiophen-2-yl)-4a,4b,8a,9a-tetrahydrocarbazole.
| Compound Name | 9-[4-[3-cyclohexa-1,3-dien-1-yl-5-(1,2-dihydropyridin-5-yl)phenyl]-1,2-dihydroquinazolin-2-yl]-2-(1,2-dihydrodibenzothiophen-2-yl)-4a,4b,8a,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 163614531 |
| Molecular Formula | C49H42N4S |
| Molecular Weight | 718.97 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 9-[4-[3-cyclohexa-1,3-dien-1-yl-5-(1,2-dihydropyridin-5-yl)phenyl]-1,2-dihydroquinazolin-2-yl]-2-(1,2-dihydrodibenzothiophen-2-yl)-4a,4b,8a,9a-tetrahydrocarbazole |
| SMILES | C1=CCCC(c2cc(C3=CNCC=C3)cc(C3=NC(N4C5C=CC=CC5C5C=CC(C6C=Cc7sc8ccccc8c7C6)=CC54)Nc4ccccc43)c2)=C1 |
| InChI | InChI=1S/C49H42N4S/c1-2-11-31(12-3-1)35-25-36(34-13-10-24-50-30-34)27-37(26-35)48-41-16-4-7-17-43(41)51-49(52-48)53-44-18-8-5-14-38(44)39-22-20-33(29-45(39)53)32-21-23-47-42(28-32)40-15-6-9-19-46(40)54-47/h1-2,4-11,13-23,25-27,29-30,32,38-39,44-45,49-51H,3,12,24,28H2 |
| InChIKey | JTSCSXLOFPCOQJ-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.97 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |