C18H26F3NO4 — CID 163616030
(2S)-2,4-dihydroxy-3,3-dimethyl-N-[(2R)-2-methyl-4-oxo-4-(2,4,5-trifluorophenyl)butyl]butanamide;methane (PubChem CID 163616030) has the molecular formula C18H26F3NO4 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2S)-2,4-dihydroxy-3,3-dimethyl-N-[(2R)-2-methyl-4-oxo-4-(2,4,5-trifluorophenyl)butyl]butanamide;methane.
| Compound Name | (2S)-2,4-dihydroxy-3,3-dimethyl-N-[(2R)-2-methyl-4-oxo-4-(2,4,5-trifluorophenyl)butyl]butanamide;methane |
|---|---|
| PubChem CID | 163616030 |
| Molecular Formula | C18H26F3NO4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2S)-2,4-dihydroxy-3,3-dimethyl-N-[(2R)-2-methyl-4-oxo-4-(2,4,5-trifluorophenyl)butyl]butanamide;methane |
| SMILES | C.C[C@@H](CNC(=O)[C@@H](O)C(C)(C)CO)CC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3NO4.CH4/c1-9(7-21-16(25)15(24)17(2,3)8-22)4-14(23)10-5-12(19)13(20)6-11(10)18;/h5-6,9,15,22,24H,4,7-8H2,1-3H3,(H,21,25);1H4/t9-,15-;/m1./s1 |
| InChIKey | HKCNRWGQEDZABG-ROTFMXTRSA-N |
| XLogP | 2.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|