C8H15N3 — CID 163619439
1,4-dimethyl-5,8-dihydro-4H-1,3-diazocin-2-amine (PubChem CID 163619439) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1,4-dimethyl-5,8-dihydro-4H-1,3-diazocin-2-amine.
| Compound Name | 1,4-dimethyl-5,8-dihydro-4H-1,3-diazocin-2-amine |
|---|---|
| PubChem CID | 163619439 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1,4-dimethyl-5,8-dihydro-4H-1,3-diazocin-2-amine |
| SMILES | CC1CC=CCN(C)/C(N)=N\1 |
| InChI | InChI=1S/C8H15N3/c1-7-5-3-4-6-11(2)8(9)10-7/h3-4,7H,5-6H2,1-2H3,(H2,9,10) |
| InChIKey | HMVKWHRHFVLRCI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|