C8H14N2 — CID 123941212
3,4-dimethyl-5,8-dihydro-4H-1,3-diazocine (PubChem CID 123941212) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 3,4-dimethyl-5,8-dihydro-4H-1,3-diazocine.
| Compound Name | 3,4-dimethyl-5,8-dihydro-4H-1,3-diazocine |
|---|---|
| PubChem CID | 123941212 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3,4-dimethyl-5,8-dihydro-4H-1,3-diazocine |
| SMILES | CC1CC=CC/N=C\N1C |
| InChI | InChI=1S/C8H14N2/c1-8-5-3-4-6-9-7-10(8)2/h3-4,7-8H,5-6H2,1-2H3/b4-3?,9-7- |
| InChIKey | KBTDVMQMCVAYLT-FBOQLPCNSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|