About N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide
N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide (PubChem CID 14967686) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide |
| PubChem CID | 14967686 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C1C=CCC1 |
| InChI | InChI=1S/C8H14N2/c1-10(2)7-9-8-5-3-4-6-8/h3,5,7-8H,4,6H2,1-2H3/b9-7+ |
| InChIKey | YQKQVPOJEVDMLV-VQHVLOKHSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide?
The IUPAC name of N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide (CID 14967686) is N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide is CN(C)/C=N/C1C=CCC1.
What is the InChIKey of N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide?
The InChIKey is YQKQVPOJEVDMLV-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H14N2/c1-10(2)7-9-8-5-3-4-6-8/h3,5,7-8H,4,6H2,1-2H3/b9-7+.
What are the key properties of N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide?
N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide has a molecular weight of 138.21 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopent-2-en-1-yl-N,N-dimethylmethanimidamide is sourced from PubChem (CID 14967686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).