C11H21N3O — CID 163621216
4-(morpholin-4-ylmethyl)cyclohex-4-ene-1,2-diamine (PubChem CID 163621216) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-(morpholin-4-ylmethyl)cyclohex-4-ene-1,2-diamine.
| Compound Name | 4-(morpholin-4-ylmethyl)cyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 163621216 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-(morpholin-4-ylmethyl)cyclohex-4-ene-1,2-diamine |
| SMILES | NC1CC=C(CN2CCOCC2)CC1N |
| InChI | InChI=1S/C11H21N3O/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14/h1,10-11H,2-8,12-13H2 |
| InChIKey | HOGJPBHQGLHLAP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|