C18H22NO4+ — CID 163622745
(1S,12S,14R)-14-hydroxy-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-3-one (PubChem CID 163622745) has the molecular formula C18H22NO4+ and a molecular weight of 316.38 g/mol. Its IUPAC name is (1S,12S,14R)-14-hydroxy-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-3-one.
| Compound Name | (1S,12S,14R)-14-hydroxy-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-3-one |
|---|---|
| PubChem CID | 163622745 |
| Molecular Formula | C18H22NO4+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1S,12S,14R)-14-hydroxy-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-3-one |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CC(=O)[N+](C)(C)C2 |
| InChI | InChI=1S/C18H22NO4/c1-19(2)10-11-4-5-13(22-3)17-16(11)18(9-15(19)21)7-6-12(20)8-14(18)23-17/h4-7,12,14,20H,8-10H2,1-3H3/q+1/t12-,14-,18-/m0/s1 |
| InChIKey | CNZMBPAOYDOEMR-YEWDVWPNSA-N |
| XLogP | 1.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|