C13H18N2O — CID 163625247
2,3,6-trimethyl-5-phenyl-1,6-dihydropyridazin-3-ol (PubChem CID 163625247) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,3,6-trimethyl-5-phenyl-1,6-dihydropyridazin-3-ol.
| Compound Name | 2,3,6-trimethyl-5-phenyl-1,6-dihydropyridazin-3-ol |
|---|---|
| PubChem CID | 163625247 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2,3,6-trimethyl-5-phenyl-1,6-dihydropyridazin-3-ol |
| SMILES | CC1NN(C)C(C)(O)C=C1c1ccccc1 |
| InChI | InChI=1S/C13H18N2O/c1-10-12(11-7-5-4-6-8-11)9-13(2,16)15(3)14-10/h4-10,14,16H,1-3H3 |
| InChIKey | HRLROFJLTGEZQD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |