About 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol
3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol (PubChem CID 142995897) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol.
Molecular Properties
| Compound Name | 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol |
| PubChem CID | 142995897 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol |
| SMILES | CC1(O)C=C(CCc2ccccc2)NN1 |
| InChI | InChI=1S/C12H16N2O/c1-12(15)9-11(13-14-12)8-7-10-5-3-2-4-6-10/h2-6,9,13-15H,7-8H2,1H3 |
| InChIKey | FNGVOAZIEJNEDG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol?
The IUPAC name of 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol (CID 142995897) is 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol.
What is the SMILES notation for 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol?
The canonical SMILES for 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol is CC1(O)C=C(CCc2ccccc2)NN1.
What is the InChIKey of 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol?
The InChIKey is FNGVOAZIEJNEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(15)9-11(13-14-12)8-7-10-5-3-2-4-6-10/h2-6,9,13-15H,7-8H2,1H3.
What are the key properties of 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol?
3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol has a molecular weight of 204.27 g/mol, XLogP of 1.32, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(2-phenylethyl)-1,2-dihydropyrazol-3-ol is sourced from PubChem (CID 142995897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).