C11H14N2O — CID 142995901
3-methyl-5-(4-methylphenyl)-1,2-dihydropyrazol-3-ol (PubChem CID 142995901) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-methyl-5-(4-methylphenyl)-1,2-dihydropyrazol-3-ol.
| Compound Name | 3-methyl-5-(4-methylphenyl)-1,2-dihydropyrazol-3-ol |
|---|---|
| PubChem CID | 142995901 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-methyl-5-(4-methylphenyl)-1,2-dihydropyrazol-3-ol |
| SMILES | Cc1ccc(C2=CC(C)(O)NN2)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-8-3-5-9(6-4-8)10-7-11(2,14)13-12-10/h3-7,12-14H,1-2H3 |
| InChIKey | BCHAVGQCZYQILC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |