C5H5IN4 — CID 163625271
8-methyl-2λ3-ioda-1,3,7,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene (PubChem CID 163625271) has the molecular formula C5H5IN4 and a molecular weight of 248.03 g/mol. Its IUPAC name is 8-methyl-2λ3-ioda-1,3,7,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene.
| Compound Name | 8-methyl-2λ3-ioda-1,3,7,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 163625271 |
| Molecular Formula | C5H5IN4 |
| Molecular Weight | 248.03 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 8-methyl-2λ3-ioda-1,3,7,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
| SMILES | Cc1nc2n(n1)I=NC=C2 |
| InChI | InChI=1S/C5H5IN4/c1-4-8-5-2-3-7-6-10(5)9-4/h2-3H,1H3 |
| InChIKey | HRMBULVKBAIAPZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.03 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|