C26H24FN3O2 — CID 163627957
3-(3-fluoro-1H-isoindol-5-yl)-N-[3-(3-methoxyphenyl)pyrrolidin-3-yl]benzamide (PubChem CID 163627957) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-(3-fluoro-1H-isoindol-5-yl)-N-[3-(3-methoxyphenyl)pyrrolidin-3-yl]benzamide.
| Compound Name | 3-(3-fluoro-1H-isoindol-5-yl)-N-[3-(3-methoxyphenyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 163627957 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-(3-fluoro-1H-isoindol-5-yl)-N-[3-(3-methoxyphenyl)pyrrolidin-3-yl]benzamide |
| SMILES | COc1cccc(C2(NC(=O)c3cccc(-c4ccc5c(c4)C(F)=NC5)c3)CCNC2)c1 |
| InChI | InChI=1S/C26H24FN3O2/c1-32-22-7-3-6-21(14-22)26(10-11-28-16-26)30-25(31)19-5-2-4-17(12-19)18-8-9-20-15-29-24(27)23(20)13-18/h2-9,12-14,28H,10-11,15-16H2,1H3,(H,30,31) |
| InChIKey | HTPVXMOULGBIHV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |