About 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane
1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane (PubChem CID 163628054) has the molecular formula C5H16IN3O
and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane.
Molecular Properties
| Compound Name | 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane |
| PubChem CID | 163628054 |
| Molecular Formula | C5H16IN3O |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane |
| SMILES | CCCONI(C)CNN |
| InChI | InChI=1S/C5H16IN3O/c1-3-4-10-9-6(2)5-8-7/h8-9H,3-5,7H2,1-2H3 |
| InChIKey | HTRMAEKBQVFPBK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane?
The IUPAC name of 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane (CID 163628054) is 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane.
What is the SMILES notation for 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane?
The canonical SMILES for 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane is CCCONI(C)CNN.
What is the InChIKey of 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane?
The InChIKey is HTRMAEKBQVFPBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H16IN3O/c1-3-4-10-9-6(2)5-8-7/h8-9H,3-5,7H2,1-2H3.
What are the key properties of 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane?
1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane has a molecular weight of 261.11 g/mol, XLogP of 0.39, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[hydrazinylmethyl(methyl)-λ3-iodanyl]amino]oxypropane is sourced from PubChem (CID 163628054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).