About (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine
(6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine (PubChem CID 163628075) has the molecular formula C9H13BrFN3
and a molecular weight of 262.13 g/mol. Its IUPAC name is (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine |
| PubChem CID | 163628075 |
| Molecular Formula | C9H13BrFN3 |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine |
| SMILES | C/C(=C1\C(F)=CC(Br)=CC1N)N(C)N |
| InChI | InChI=1S/C9H13BrFN3/c1-5(14(2)13)9-7(11)3-6(10)4-8(9)12/h3-4,8H,12-13H2,1-2H3/b9-5- |
| InChIKey | HTRYJFAUTDGUKV-UITAMQMPSA-N |
| XLogP | 1.54 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine?
The IUPAC name of (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine (CID 163628075) is (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine?
The canonical SMILES for (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine is C/C(=C1\C(F)=CC(Br)=CC1N)N(C)N.
What is the InChIKey of (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine?
The InChIKey is HTRYJFAUTDGUKV-UITAMQMPSA-N. The full InChI is InChI=1S/C9H13BrFN3/c1-5(14(2)13)9-7(11)3-6(10)4-8(9)12/h3-4,8H,12-13H2,1-2H3/b9-5-.
What are the key properties of (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine?
(6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine has a molecular weight of 262.13 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[1-[amino(methyl)amino]ethylidene]-3-bromo-5-fluorocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 163628075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).