C8H11BrN2 — CID 158154542
3-bromo-N,5-dimethyl-2-methylidenepyridin-1-amine (PubChem CID 158154542) has the molecular formula C8H11BrN2 and a molecular weight of 215.09 g/mol. Its IUPAC name is 3-bromo-N,5-dimethyl-2-methylidenepyridin-1-amine.
| Compound Name | 3-bromo-N,5-dimethyl-2-methylidenepyridin-1-amine |
|---|---|
| PubChem CID | 158154542 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3-bromo-N,5-dimethyl-2-methylidenepyridin-1-amine |
| SMILES | C=C1C(Br)=CC(C)=CN1NC |
| InChI | InChI=1S/C8H11BrN2/c1-6-4-8(9)7(2)11(5-6)10-3/h4-5,10H,2H2,1,3H3 |
| InChIKey | JTONUENUYURHSV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |