C13H19N3 — CID 155684855
[2-[[(1Z)-buta-1,3-dienyl]-(methylamino)amino]cyclohepta-1,3,6-trien-1-yl]methanamine (PubChem CID 155684855) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is [2-[[(1Z)-buta-1,3-dienyl]-(methylamino)amino]cyclohepta-1,3,6-trien-1-yl]methanamine.
| Compound Name | [2-[[(1Z)-buta-1,3-dienyl]-(methylamino)amino]cyclohepta-1,3,6-trien-1-yl]methanamine |
|---|---|
| PubChem CID | 155684855 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | [2-[[(1Z)-buta-1,3-dienyl]-(methylamino)amino]cyclohepta-1,3,6-trien-1-yl]methanamine |
| SMILES | C=C/C=C\N(NC)C1=C(CN)C=CCC=C1 |
| InChI | InChI=1S/C13H19N3/c1-3-4-10-16(15-2)13-9-7-5-6-8-12(13)11-14/h3-4,6-10,15H,1,5,11,14H2,2H3/b10-4- |
| InChIKey | INHAKLDRFVSOBF-WMZJFQQLSA-N |
| XLogP | 1.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|