C10H15N3 — CID 163702474
5-cyclohexa-1,5-dien-1-yl-2,3-dimethyl-1H-triazole (PubChem CID 163702474) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-2,3-dimethyl-1H-triazole.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-2,3-dimethyl-1H-triazole |
|---|---|
| PubChem CID | 163702474 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-2,3-dimethyl-1H-triazole |
| SMILES | CN1C=C(C2=CCCC=C2)NN1C |
| InChI | InChI=1S/C10H15N3/c1-12-8-10(11-13(12)2)9-6-4-3-5-7-9/h4,6-8,11H,3,5H2,1-2H3 |
| InChIKey | KCFPTJHONFKIFB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |