C14H28N2 — CID 166097215
(2Z)-N,3-dimethyl-2-propylidenepyridin-1-amine;ethane (PubChem CID 166097215) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (2Z)-N,3-dimethyl-2-propylidenepyridin-1-amine;ethane.
| Compound Name | (2Z)-N,3-dimethyl-2-propylidenepyridin-1-amine;ethane |
|---|---|
| PubChem CID | 166097215 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (2Z)-N,3-dimethyl-2-propylidenepyridin-1-amine;ethane |
| SMILES | CC.CC.CC/C=C1/C(C)=CC=CN1NC |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-4-6-10-9(2)7-5-8-12(10)11-3;2*1-2/h5-8,11H,4H2,1-3H3;2*1-2H3/b10-6-;; |
| InChIKey | CWDZVSGDQMRGSC-LVLXLXDWSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |