C9H16N2 — CID 171384060
2-ethyl-3,4,6-trimethyl-1H-pyridazine (PubChem CID 171384060) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-ethyl-3,4,6-trimethyl-1H-pyridazine.
| Compound Name | 2-ethyl-3,4,6-trimethyl-1H-pyridazine |
|---|---|
| PubChem CID | 171384060 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-ethyl-3,4,6-trimethyl-1H-pyridazine |
| SMILES | CCN1NC(C)=CC(C)=C1C |
| InChI | InChI=1S/C9H16N2/c1-5-11-9(4)7(2)6-8(3)10-11/h6,10H,5H2,1-4H3 |
| InChIKey | VBHYEBMPHKAXNX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |