C22H33F2NO3 — CID 163629394
methyl 7-[(5R)-5-[(E,3R,4R)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 163629394) has the molecular formula C22H33F2NO3 and a molecular weight of 397.51 g/mol. Its IUPAC name is methyl 7-[(5R)-5-[(E,3R,4R)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-5-[(E,3R,4R)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 163629394 |
| Molecular Formula | C22H33F2NO3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | methyl 7-[(5R)-5-[(E,3R,4R)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CC#CC[C@@H](C)[C@@H](C)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H33F2NO3/c1-5-6-11-17(2)18(3)13-14-19-16-22(23,24)21(27)25(19)15-10-8-7-9-12-20(26)28-4/h13-14,17-19H,7-12,15-16H2,1-4H3/b14-13+/t17-,18+,19+/m1/s1 |
| InChIKey | HUUHZZDQOXBPLO-CRDZFEMVSA-N |
| XLogP | 4.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|