C24H18N6O3 — CID 163630022
3-hydroxy-4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)hydrazinyl]-N-pyridin-4-ylnaphthalene-2-carboxamide (PubChem CID 163630022) has the molecular formula C24H18N6O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-hydroxy-4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)hydrazinyl]-N-pyridin-4-ylnaphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)hydrazinyl]-N-pyridin-4-ylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 163630022 |
| Molecular Formula | C24H18N6O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-hydroxy-4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)hydrazinyl]-N-pyridin-4-ylnaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc2ccccc2c(NNc2nnc(-c3ccccc3)o2)c1O |
| InChI | InChI=1S/C24H18N6O3/c31-21-19(22(32)26-17-10-12-25-13-11-17)14-16-8-4-5-9-18(16)20(21)27-29-24-30-28-23(33-24)15-6-2-1-3-7-15/h1-14,27,31H,(H,29,30)(H,25,26,32) |
| InChIKey | HVHGRXAZONUGME-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|