C16H19NO — CID 163630216
4-[4-(1-aminoprop-2-enyl)cyclohexa-1,4-dien-1-yl]cyclohepta-1,3,5-trien-1-ol (PubChem CID 163630216) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-[4-(1-aminoprop-2-enyl)cyclohexa-1,4-dien-1-yl]cyclohepta-1,3,5-trien-1-ol.
| Compound Name | 4-[4-(1-aminoprop-2-enyl)cyclohexa-1,4-dien-1-yl]cyclohepta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 163630216 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-[4-(1-aminoprop-2-enyl)cyclohexa-1,4-dien-1-yl]cyclohepta-1,3,5-trien-1-ol |
| SMILES | C=CC(N)C1=CCC(C2=CC=C(O)CC=C2)=CC1 |
| InChI | InChI=1S/C16H19NO/c1-2-16(17)14-8-6-13(7-9-14)12-4-3-5-15(18)11-10-12/h2-4,6,9-11,16,18H,1,5,7-8,17H2 |
| InChIKey | HVLIBTCPDQEGQC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|