C20H27N5O2 — CID 163632437
[2-[(1-hydroxycyclobutyl)methylamino]-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]-(1H-indol-2-yl)methanone (PubChem CID 163632437) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is [2-[(1-hydroxycyclobutyl)methylamino]-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [2-[(1-hydroxycyclobutyl)methylamino]-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 163632437 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [2-[(1-hydroxycyclobutyl)methylamino]-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN2NC(NCC3(O)CCC3)CC2C1 |
| InChI | InChI=1S/C20H27N5O2/c26-19(17-10-14-4-1-2-5-16(14)22-17)24-8-9-25-15(12-24)11-18(23-25)21-13-20(27)6-3-7-20/h1-2,4-5,10,15,18,21-23,27H,3,6-9,11-13H2 |
| InChIKey | HXHIEBKEOPUBNU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |