C23H25FN7O2+ — CID 163632657
amino-[amino-[4-[1-[[6-[(4-fluorophenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]ethyl]phenyl]methylidene]-methylazanium (PubChem CID 163632657) has the molecular formula C23H25FN7O2+ and a molecular weight of 450.50 g/mol. Its IUPAC name is amino-[amino-[4-[1-[[6-[(4-fluorophenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]ethyl]phenyl]methylidene]-methylazanium.
| Compound Name | amino-[amino-[4-[1-[[6-[(4-fluorophenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]ethyl]phenyl]methylidene]-methylazanium |
|---|---|
| PubChem CID | 163632657 |
| Molecular Formula | C23H25FN7O2+ |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | amino-[amino-[4-[1-[[6-[(4-fluorophenyl)methylcarbamoyl]pyrimidine-4-carbonyl]amino]ethyl]phenyl]methylidene]-methylazanium |
| SMILES | CC(NC(=O)c1cc(C(=O)NCc2ccc(F)cc2)ncn1)c1ccc(C(N)=[N+](C)N)cc1 |
| InChI | InChI=1S/C23H24FN7O2/c1-14(16-5-7-17(8-6-16)21(25)31(2)26)30-23(33)20-11-19(28-13-29-20)22(32)27-12-15-3-9-18(24)10-4-15/h3-11,13-14,25H,12,26H2,1-2H3,(H2,27,30,32,33)/p+1 |
| InChIKey | ITYNJTMQCADRND-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|