C17H24ClN6O2+ — CID 163633727
[4-[amino-[(4-methoxyphenyl)methyl]amino]-2-chloro-6-(3-hydroxypyrrolidin-1-yl)pyrimidin-5-yl]-methylazanium (PubChem CID 163633727) has the molecular formula C17H24ClN6O2+ and a molecular weight of 379.87 g/mol. Its IUPAC name is [4-[amino-[(4-methoxyphenyl)methyl]amino]-2-chloro-6-(3-hydroxypyrrolidin-1-yl)pyrimidin-5-yl]-methylazanium.
| Compound Name | [4-[amino-[(4-methoxyphenyl)methyl]amino]-2-chloro-6-(3-hydroxypyrrolidin-1-yl)pyrimidin-5-yl]-methylazanium |
|---|---|
| PubChem CID | 163633727 |
| Molecular Formula | C17H24ClN6O2+ |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [4-[amino-[(4-methoxyphenyl)methyl]amino]-2-chloro-6-(3-hydroxypyrrolidin-1-yl)pyrimidin-5-yl]-methylazanium |
| SMILES | C[NH2+]c1c(N(N)Cc2ccc(OC)cc2)nc(Cl)nc1N1CCC(O)C1 |
| InChI | InChI=1S/C17H23ClN6O2/c1-20-14-15(23-8-7-12(25)10-23)21-17(18)22-16(14)24(19)9-11-3-5-13(26-2)6-4-11/h3-6,12,20,25H,7-10,19H2,1-2H3/p+1 |
| InChIKey | HYHGFVCDMMAVJH-UHFFFAOYSA-O |
| XLogP | 0.41 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|