C18H25ClN6O2 — CID 138631350
1-[[(3S)-1-[5-amino-2-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]pyrrolidin-3-yl]amino]ethanol (PubChem CID 138631350) has the molecular formula C18H25ClN6O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[[(3S)-1-[5-amino-2-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]pyrrolidin-3-yl]amino]ethanol.
| Compound Name | 1-[[(3S)-1-[5-amino-2-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]pyrrolidin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 138631350 |
| Molecular Formula | C18H25ClN6O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[[(3S)-1-[5-amino-2-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-4-yl]pyrrolidin-3-yl]amino]ethanol |
| SMILES | COc1ccc(CNc2nc(Cl)nc(N3CC[C@H](NC(C)O)C3)c2N)cc1 |
| InChI | InChI=1S/C18H25ClN6O2/c1-11(26)22-13-7-8-25(10-13)17-15(20)16(23-18(19)24-17)21-9-12-3-5-14(27-2)6-4-12/h3-6,11,13,22,26H,7-10,20H2,1-2H3,(H,21,23,24)/t11?,13-/m0/s1 |
| InChIKey | GONRIWXSZKKGRY-YUZLPWPTSA-N |
| XLogP | 1.84 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|