C36H32BBrF4N4O4 — CID 163635117
4-bromo-2,6-difluorobenzaldehyde;2,6-difluoro-4-(2-methylindazol-4-yl)benzaldehyde;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 163635117) has the molecular formula C36H32BBrF4N4O4 and a molecular weight of 751.38 g/mol. Its IUPAC name is 4-bromo-2,6-difluorobenzaldehyde;2,6-difluoro-4-(2-methylindazol-4-yl)benzaldehyde;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-bromo-2,6-difluorobenzaldehyde;2,6-difluoro-4-(2-methylindazol-4-yl)benzaldehyde;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 163635117 |
| Molecular Formula | C36H32BBrF4N4O4 |
| Molecular Weight | 751.38 g/mol |
| Exact Mass | 750.16 |
| IUPAC Name | 4-bromo-2,6-difluorobenzaldehyde;2,6-difluoro-4-(2-methylindazol-4-yl)benzaldehyde;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc2c(-c3cc(F)c(C=O)c(F)c3)cccc2n1.Cn1cc2c(B3OC(C)(C)C(C)(C)O3)cccc2n1.O=Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H10F2N2O.C14H19BN2O2.C7H3BrF2O/c1-19-7-11-10(3-2-4-15(11)18-19)9-5-13(16)12(8-20)14(17)6-9;1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-17(5)16-12;8-4-1-6(9)5(3-11)7(10)2-4/h2-8H,1H3;6-9H,1-5H3;1-3H |
| InChIKey | HZKSTTVXBWKTFO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.38 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|