C16H25NO5 — CID 163636157
tert-butyl (1R,5S)-6-(4-ethoxy-2,4-dioxobutyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 163636157) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl (1R,5S)-6-(4-ethoxy-2,4-dioxobutyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1R,5S)-6-(4-ethoxy-2,4-dioxobutyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 163636157 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl (1R,5S)-6-(4-ethoxy-2,4-dioxobutyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CCOC(=O)CC(=O)CC1[C@H]2CN(C(=O)OC(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C16H25NO5/c1-5-21-14(19)7-10(18)6-11-12-8-17(9-13(11)12)15(20)22-16(2,3)4/h11-13H,5-9H2,1-4H3/t11?,12-,13+ |
| InChIKey | IAGSMUQWSXFMTG-YHWZYXNKSA-N |
| XLogP | 2.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|