About N-propyl-N'-prop-2-ynylbutanediamide
N-propyl-N'-prop-2-ynylbutanediamide (PubChem CID 163636488) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-propyl-N'-prop-2-ynylbutanediamide.
Molecular Properties
| Compound Name | N-propyl-N'-prop-2-ynylbutanediamide |
| PubChem CID | 163636488 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-propyl-N'-prop-2-ynylbutanediamide |
| SMILES | C#CCNC(=O)CCC(=O)NCCC |
| InChI | InChI=1S/C10H16N2O2/c1-3-7-11-9(13)5-6-10(14)12-8-4-2/h1H,4-8H2,2H3,(H,11,13)(H,12,14) |
| InChIKey | IANVYVVILICFQM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-N'-prop-2-ynylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-N'-prop-2-ynylbutanediamide?
The IUPAC name of N-propyl-N'-prop-2-ynylbutanediamide (CID 163636488) is N-propyl-N'-prop-2-ynylbutanediamide.
What is the SMILES notation for N-propyl-N'-prop-2-ynylbutanediamide?
The canonical SMILES for N-propyl-N'-prop-2-ynylbutanediamide is C#CCNC(=O)CCC(=O)NCCC.
What is the InChIKey of N-propyl-N'-prop-2-ynylbutanediamide?
The InChIKey is IANVYVVILICFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-3-7-11-9(13)5-6-10(14)12-8-4-2/h1H,4-8H2,2H3,(H,11,13)(H,12,14).
What are the key properties of N-propyl-N'-prop-2-ynylbutanediamide?
N-propyl-N'-prop-2-ynylbutanediamide has a molecular weight of 196.25 g/mol, XLogP of 0.04, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-N'-prop-2-ynylbutanediamide is sourced from PubChem (CID 163636488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).