C14H20Br2N2O — CID 163636974
1-(4-amino-3,5-dibromophenyl)-2-(2-methylpiperidin-1-yl)ethanol (PubChem CID 163636974) has the molecular formula C14H20Br2N2O and a molecular weight of 392.14 g/mol. Its IUPAC name is 1-(4-amino-3,5-dibromophenyl)-2-(2-methylpiperidin-1-yl)ethanol.
| Compound Name | 1-(4-amino-3,5-dibromophenyl)-2-(2-methylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 163636974 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 1-(4-amino-3,5-dibromophenyl)-2-(2-methylpiperidin-1-yl)ethanol |
| SMILES | CC1CCCCN1CC(O)c1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C14H20Br2N2O/c1-9-4-2-3-5-18(9)8-13(19)10-6-11(15)14(17)12(16)7-10/h6-7,9,13,19H,2-5,8,17H2,1H3 |
| InChIKey | IAZPZTXKJMZLCO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|