C17H19F3O3S — CID 163637742
[4-(3,3,3-trifluoropropoxy)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 163637742) has the molecular formula C17H19F3O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is [4-(3,3,3-trifluoropropoxy)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(3,3,3-trifluoropropoxy)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163637742 |
| Molecular Formula | C17H19F3O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [4-(3,3,3-trifluoropropoxy)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)SCC=C2OCCC(F)(F)F |
| InChI | InChI=1S/C17H19F3O3S/c1-16(2,3)15(21)23-11-4-5-12-13(6-9-24-14(12)10-11)22-8-7-17(18,19)20/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | IBQKSKPBGVIRLX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|