C46H39NO7 — CID 163639003
[4-[2-[4-[1-[4-[1-(4-methoxyphenyl)-3-oxo-2-phenylisoindol-1-yl]phenoxy]-2-oxoethoxy]phenyl]propan-2-yl]phenyl] acetate (PubChem CID 163639003) has the molecular formula C46H39NO7 and a molecular weight of 717.82 g/mol. Its IUPAC name is [4-[2-[4-[1-[4-[1-(4-methoxyphenyl)-3-oxo-2-phenylisoindol-1-yl]phenoxy]-2-oxoethoxy]phenyl]propan-2-yl]phenyl] acetate.
| Compound Name | [4-[2-[4-[1-[4-[1-(4-methoxyphenyl)-3-oxo-2-phenylisoindol-1-yl]phenoxy]-2-oxoethoxy]phenyl]propan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 163639003 |
| Molecular Formula | C46H39NO7 |
| Molecular Weight | 717.82 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | [4-[2-[4-[1-[4-[1-(4-methoxyphenyl)-3-oxo-2-phenylisoindol-1-yl]phenoxy]-2-oxoethoxy]phenyl]propan-2-yl]phenyl] acetate |
| SMILES | COc1ccc(C2(c3ccc(OC(C=O)Oc4ccc(C(C)(C)c5ccc(OC(C)=O)cc5)cc4)cc3)c3ccccc3C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C46H39NO7/c1-31(49)52-38-24-14-32(15-25-38)45(2,3)33-16-26-39(27-17-33)53-43(30-48)54-40-28-20-35(21-29-40)46(34-18-22-37(51-4)23-19-34)42-13-9-8-12-41(42)44(50)47(46)36-10-6-5-7-11-36/h5-30,43H,1-4H3 |
| InChIKey | ICPCAQPWXQFLBR-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.82 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|