C19H28O2S — CID 163639825
(12R)-5-methyl-15-sulfanyl-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadecan-6-one (PubChem CID 163639825) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (12R)-5-methyl-15-sulfanyl-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadecan-6-one.
| Compound Name | (12R)-5-methyl-15-sulfanyl-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadecan-6-one |
|---|---|
| PubChem CID | 163639825 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (12R)-5-methyl-15-sulfanyl-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadecan-6-one |
| SMILES | CC12CCC3C(C[C@H]4OCC35CCC(S)CC45)C1CCC2=O |
| InChI | InChI=1S/C19H28O2S/c1-18-6-5-14-12(13(18)2-3-17(18)20)9-16-15-8-11(22)4-7-19(14,15)10-21-16/h11-16,22H,2-10H2,1H3/t11?,12?,13?,14?,15?,16-,18?,19?/m1/s1 |
| InChIKey | IDHFNJCIBMPRNZ-FFJMVZCVSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|