C18H22N5O3+ — CID 163640174
N-[3-[4-(1-hydroxyethyl)-1,2-dihydrotriazol-2-ium-3-yl]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 163640174) has the molecular formula C18H22N5O3+ and a molecular weight of 356.41 g/mol. Its IUPAC name is N-[3-[4-(1-hydroxyethyl)-1,2-dihydrotriazol-2-ium-3-yl]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[4-(1-hydroxyethyl)-1,2-dihydrotriazol-2-ium-3-yl]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 163640174 |
| Molecular Formula | C18H22N5O3+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[3-[4-(1-hydroxyethyl)-1,2-dihydrotriazol-2-ium-3-yl]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(O)C1=CN[NH2+]N1C1CC(NC(=O)c2cc(-c3ccccc3)on2)C1 |
| InChI | InChI=1S/C18H21N5O3/c1-11(24)16-10-19-22-23(16)14-7-13(8-14)20-18(25)15-9-17(26-21-15)12-5-3-2-4-6-12/h2-6,9-11,13-14,19,22,24H,7-8H2,1H3,(H,20,25)/p+1 |
| InChIKey | IDOMPNGYQBWHHO-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|