C22H27N6O2+ — CID 163640643
4-iminopent-2-en-2-yl-[4-[4-(pyridin-3-ylcarbamoyl)piperazine-1-carbonyl]phenyl]azanium (PubChem CID 163640643) has the molecular formula C22H27N6O2+ and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-iminopent-2-en-2-yl-[4-[4-(pyridin-3-ylcarbamoyl)piperazine-1-carbonyl]phenyl]azanium.
| Compound Name | 4-iminopent-2-en-2-yl-[4-[4-(pyridin-3-ylcarbamoyl)piperazine-1-carbonyl]phenyl]azanium |
|---|---|
| PubChem CID | 163640643 |
| Molecular Formula | C22H27N6O2+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-iminopent-2-en-2-yl-[4-[4-(pyridin-3-ylcarbamoyl)piperazine-1-carbonyl]phenyl]azanium |
| SMILES | [H]/N=C(\C)C=C(C)[NH2+]c1ccc(C(=O)N2CCN(C(=O)Nc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-16(23)14-17(2)25-19-7-5-18(6-8-19)21(29)27-10-12-28(13-11-27)22(30)26-20-4-3-9-24-15-20/h3-9,14-15,23,25H,10-13H2,1-2H3,(H,26,30)/p+1/b17-14?,23-16+ |
| InChIKey | IDYVIWIRHIOYGX-FDAZBKMASA-O |
| XLogP | 2.21 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|