C25H33N5O2 — CID 70997266
4-[4-(2-cyclohexylethylamino)benzoyl]-N-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 70997266) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[4-(2-cyclohexylethylamino)benzoyl]-N-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | 4-[4-(2-cyclohexylethylamino)benzoyl]-N-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70997266 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 4-[4-(2-cyclohexylethylamino)benzoyl]-N-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccnc1)N1CCN(C(=O)c2ccc(NCCC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N5O2/c31-24(21-8-10-22(11-9-21)27-14-12-20-5-2-1-3-6-20)29-15-17-30(18-16-29)25(32)28-23-7-4-13-26-19-23/h4,7-11,13,19-20,27H,1-3,5-6,12,14-18H2,(H,28,32) |
| InChIKey | UXCIMHBMIKEHTD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |