C8H9BrClN3OS — CID 163642468
1-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-methylsulfanylpropan-2-one (PubChem CID 163642468) has the molecular formula C8H9BrClN3OS and a molecular weight of 310.60 g/mol. Its IUPAC name is 1-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-methylsulfanylpropan-2-one.
| Compound Name | 1-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-methylsulfanylpropan-2-one |
|---|---|
| PubChem CID | 163642468 |
| Molecular Formula | C8H9BrClN3OS |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | 1-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-methylsulfanylpropan-2-one |
| SMILES | CSC(Nc1nc(Cl)ncc1Br)C(C)=O |
| InChI | InChI=1S/C8H9BrClN3OS/c1-4(14)7(15-2)12-6-5(9)3-11-8(10)13-6/h3,7H,1-2H3,(H,11,12,13) |
| InChIKey | IFLFZJCKFHRIPR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|