C11H9I2N6- — CID 163642953
CID 163642953 (PubChem CID 163642953) has the molecular formula C11H9I2N6- and a molecular weight of 479.04 g/mol.
| Compound Name | CID 163642953 |
|---|---|
| PubChem CID | 163642953 |
| Molecular Formula | C11H9I2N6- |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.90 |
| IUPAC Name | — |
| SMILES | N#CC[IH-](I)n1cc(-c2ncnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C11H8I2N6/c12-13(2-3-14)19-6-8(5-18-19)10-9-1-4-15-11(9)17-7-16-10/h1,4-7H,2H2,(H,15,16,17)/q-1 |
| InChIKey | CXPAPZOACHYWTO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|